MediaWiki:Common.less/mainpage.less: Difference between revisions
(Created page with "→=================== MAIN PAGE ===================: →=================== variables ===================: @mp-text-light: fade( @white, 90% ); @mp-gutter-width: .9rem; →unused :root { --bigtile-background-color: #f9f3eb; --bigtile-background-fade-zero: fade(#f9f3eb, 0%); --bigtile-background-fade-seventyfive: fade(#f9f3eb, 75%); }: →=================== mixins ===================: // skill training colors .skill-col...") |
No edit summary |
||
| Line 1: | Line 1: | ||
/* =================== MAIN PAGE =================== *//* =================== variables =================== */@mp-text-light: fade( @white, 90% );@mp-gutter-width: .9rem;/* unused:root { --bigtile-background-color: #f9f3eb; --bigtile-background-fade-zero: fade(#f9f3eb, 0%); --bigtile-background-fade-seventyfive: fade(#f9f3eb, 75%);}*//* =================== mixins =================== */// skill training colors.skill-color(@color) { // icon span a { background: desaturate( lighten( @color, 15% ), 20% ); } // skill name &:hover > a:last-child { background: @color; }}/* ========================== page-specific styles ========================== */body.page-Old_School_RuneScape_Wiki { // limit max width for readability // don't use #mw-content-text because it includes the editform .mw-parser-output { max-width: 75em; margin: 0 auto; } // not when editing &.action-view { .catlinks, #contentSub, // hide pagetitle in favor of .mainpage-header // Note: as of mw1.38, this is not needed anymore // blanking both [[MediaWiki:Mainpage-title-loggedin]] & // [[MediaWiki:Mainpage-title]] applies an inline `display: none;` // #firstHeading, // anything listed in the sitenotice should already be on the main page #siteNotice { display: none; } }}/* ==================== general styles ==================== */.mainpage-header { display: flex; margin: 2.6em 1.75em 1.5em; .header-intro { flex: 2; h1 { font-size: 2.5em; font-weight: bold; border: none; margin: 0 0 .15em; } p { font-size: 1.1em; line-height: 1.7em; } } .header-stats { flex: 1; display: flex; justify-content: center; align-items: center; margin-top: -1em; }}// main sections.mainpage-body { display: grid; grid-template-areas: "event event event" // for tbzr tile "update update update" "content content content" "left left right"; gap: 0.9rem; grid-template-columns: repeat(3, 1fr); h2 a { color: var(--text-color); } .tile { padding-left: 1.75em; padding-right: 1.75em; max-width: 100%; } .tile-row { width: 100%; margin-bottom: 0; }}.mainpage-body .tile-row { display: grid; gap: 0.9rem}// left column.mainpage-left { grid-area: left; flex: 2; display: flex; flex-flow: column wrap; > * { margin: 0 0 @mp-gutter-width; }}// right column.mainpage-right { grid-area: right; flex: 1; display: flex; flex-flow: column wrap; > * { margin: 0 0 @mp-gutter-width; }}/* ==================== components ==================== */.arrow { background: url('/images/rss/White-chevron.svg') no-repeat; display: inline-block; height: .7rem; width: .45rem; vertical-align: middle; &.dark { filter: invert(80%); }}/* ============================= section-specific styles ============================= *//* -------------------- recent updates -------------------- */// big tile/* unused.tile.big-tile { width: 100%; background: linear-gradient(to left, var(--bigtile-background-fade-zero), var(--bigtile-background-fade-seventyfive), var(--bigtile-background-color) 40%), url("/images/rss/Main page Twisted League.png") right / auto 100% no-repeat @white; margin-bottom: @mp-gutter-width; padding-right: 8vw;} */.mainpage-recent-updates { grid-area: update; grid-template-columns: repeat(3, 1fr); .tile-halves { flex: 1; align-content: flex-start; // zoom on hover &:hover .tile-top img { transform: scale(1.04); } .tile-top span { width: 100%; } } .tile-bottom.link-button a { text-align: left; padding: 1rem 1.5rem .75rem; } h2 { margin: -0.5em 0 .3em; } p:not(.byline) { font-size: .9em; line-height: 1.75em; color: var(--text-color); }}/* -------------------- wiki contents -------------------- */@mp-contents-height: 4.5rem;.mainpage-contents { grid-area: content; grid-template-columns: repeat(6, 1fr); .tile-halves { flex: 1; } .tile-top { position: relative; // needed for ribbon } h2 { margin: 0; padding: 0; } .tile-bottom.link-button a { padding: 0.75em 0.2em; // prevent grid gap misalignment }}/* -------------------- skill training -------------------- */.mainpage-skills { ul { columns: 3 9em; margin: 1em .7em .7em 1em; } // skill row li { display: flex; margin-bottom: .29em; // skill icon span a { border-radius: @border-radius; padding: 4px; width: 25px; height: 25px; text-align: center; display: flex; justify-content: center; align-items: center; } // skill text > a:last-child { flex: 1; display: flex; align-items: center; font-weight: bold; padding-left: .7em; text-decoration: none; } &:hover { a:first-child { border-radius: @border-radius 0 0 @border-radius; } > a:last-child { color: @mp-text-light; border-radius: 0 @border-radius @border-radius 0; } } }}.skill-agility,.skill-melee { .skill-color( #932419 ); // red}.skill-ranged { .skill-color( #4c6215 ); // green}.skill-magic { .skill-color( #304791 ); // blurple}.skill-fishing,.skill-fletching { .skill-color( #1a6671 ); // bluish}.skill-cooking,.skill-thieving { .skill-color( #713684 ); // purple}.skill-farming,.skill-woodcutting { .skill-color( #306f25 ); // dark green}.skill-mining { .skill-color( #315f8d ); // dark blue}.skill-smithing { .skill-color( #b69213 ); // gold}/* -------------------- popular pages -------------------- */.popular-pages ul { display: grid; grid-template-columns: repeat(3, 1fr); grid-gap: .6em; margin: 1em 0 .7em 0;}// skill row.mp-popular-page-light { display: flex; align-items: center; background-color: var(--button-background); transition: 100ms; a { flex: 1; display: block; color: @white; font-weight: bold; text-align: center; text-decoration: none; padding: .7em 1em; } &:hover { filter: brightness(115%); transition: 100ms; }}/* -------------------- discord server -------------------- */.mainpage-discord { border: none; box-shadow: @box-shadow-dark; .tile-top { display: flex; align-items: center; background: @discord-bg; padding: 1em 1.75em; a { flex: 1; position: relative; // allow link to cover icon text-decoration: none; &:hover .arrow { transform: translateX(50%); } } } .tile-bottom { background: @discord-bg-dark; border: none; padding: 1em 1.75em; p { color: @white; font-weight: bold; font-size: .9em; text-align: center; text-transform: uppercase; letter-spacing: .03em; margin: 0; } } .partner-icon { margin-right: .75em; } .server-name { color: @white; font-weight: bold; font-size: 1.25em; margin: .5em 0 -0.15em; } .server-tagline { color: @mp-text-light; margin-bottom: .5em; } .arrow { position: absolute; top: ~"calc(50% - .5em)"; // center arrow on its point right: 0; height: 1em; width: .7em; background-size: .7em 1em; transition: .3s ease-out; }}/* -------------------- X / Twitter --------------------*/@twitter-bg: #15202b;@twitter-bg-dark: #121c26;.mainpage-twitter { border: none; box-shadow: @box-shadow-dark; .tile-top { display: flex; align-items: center; background: @twitter-bg; padding: 1em 1.75em; a { flex: 1; position: relative; // allow link to cover icon text-decoration: none; &:hover .arrow { transform: translateX(50%); } } } .tile-bottom { background: @twitter-bg-dark; border: none; padding: 1em 1.75em; p { color: @white; font-weight: bold; font-size: .9em; text-align: center; text-transform: uppercase; letter-spacing: .03em; margin: 0; } } .twitter-logo { margin-right: .75em; } .twitter-name { color: @white; font-weight: bold; font-size: 1.25em; margin: .5em 0 -0.15em; } .twitter-tagline { color: @mp-text-light; margin-bottom: .5em; } .arrow { position: absolute; top: ~"calc(50% - .5em)"; // center arrow on its point right: 0; height: 1em; width: .7em; background-size: .7em 1em; transition: .3s ease-out; }}/* -------------------- edit the wiki -------------------- */.mainpage-editing { border: none; box-shadow: @box-shadow-dark; .tile-top { background: @steel-blue; } .tile-bottom { background: saturate( darken( @steel-blue, 4% ), 4% ); border: none; padding: .8rem 1.5rem .4rem; } h2, a { color: @white; } p { color: @mp-text-light; } ul { list-style-image: url('/images/rss/Transparent-chevron.svg'); }}/* ========================== poll ========================== */.mainpage-poll .ajaxpoll { border: none; background: none; padding: 0; width: auto;}/* ========================== tbz(r) tile ========================== */.mainpage-trailblazer { grid-area: event; .tb-logo { margin-bottom: @mp-gutter-width; } .tile-row { grid-template-columns: repeat(3,1fr); @media only screen and (max-width: @width-breakpoint-tablet) { grid-template-columns: none; .tile-top { height: 20vw; min-height: 9em; } } }}/* ========================== media queries ========================== */@media only screen and (max-width: @width-breakpoint-desktop-wide) { // switch to two rows of three tiles .mainpage-contents { grid-template-columns: repeat(3, 1fr) }}@media only screen and (max-width: @width-breakpoint-desktop) { // mainpage-left and -right on one column now .mainpage-body { grid-template-areas: "event event event" // for tbzr tile "update update update" "content content content" "left left left" "right right right"; } .mainpage-recent-updates { grid-template-columns: repeat(2, 1fr); .tile-halves { // hide third recent update &:last-child { display: none; } // zoom on hover &:hover .tile-top img { transform: scale(1.04); } } .tile-top { height: 18vw; min-height: 9em; } } // hide other things .mainpage-header .header-stats { display: none; } // kill margin as it duplicates grid's gap .mainpage-left > *:last-child, .mainpage-right > *:last-child { margin-bottom: 0; } .popular-pages ul { grid-template-columns: repeat(2, 1fr); }}@media only screen and (max-width: @width-breakpoint-tablet) { .mainpage-recent-updates { // resulting in single column grid-template-columns: none; // revert display:none .tile-halves:last-child { display: flex; } } // switch to three rows of two tiles .mainpage-contents { grid-template-columns: repeat(2, 1fr); }} |
|||
/* =================== |
|||
MAIN PAGE |
|||
=================== */ |
|||
/* =================== |
|||
variables |
|||
=================== */ |
|||
@mp-text-light: fade( @white, 90% ); |
|||
@mp-gutter-width: .9rem; |
|||
/* unused |
|||
:root { |
|||
--bigtile-background-color: #f9f3eb; |
|||
--bigtile-background-fade-zero: fade(#f9f3eb, 0%); |
|||
--bigtile-background-fade-seventyfive: fade(#f9f3eb, 75%); |
|||
} |
|||
*/ |
|||
/* =================== |
|||
mixins |
|||
=================== */ |
|||
// skill training colors |
|||
.skill-color(@color) { |
|||
// icon |
|||
span a { |
|||
background: desaturate( lighten( @color, 15% ), 20% ); |
|||
} |
|||
// skill name |
|||
&:hover > a:last-child { |
|||
background: @color; |
|||
} |
|||
} |
|||
/* ========================== |
|||
page-specific styles |
|||
========================== */ |
|||
body.page-Old_School_RuneScape_Wiki { |
|||
// limit max width for readability |
|||
// don't use #mw-content-text because it includes the editform |
|||
.mw-parser-output { |
|||
max-width: 75em; |
|||
margin: 0 auto; |
|||
} |
|||
// not when editing |
|||
&.action-view { |
|||
.catlinks, |
|||
#contentSub, |
|||
// hide pagetitle in favor of .mainpage-header |
|||
// Note: as of mw1.38, this is not needed anymore |
|||
// blanking both [[MediaWiki:Mainpage-title-loggedin]] & |
|||
// [[MediaWiki:Mainpage-title]] applies an inline `display: none;` |
|||
// #firstHeading, |
|||
// anything listed in the sitenotice should already be on the main page |
|||
#siteNotice { |
|||
display: none; |
|||
} |
|||
} |
|||
} |
|||
/* ==================== |
|||
general styles |
|||
==================== */ |
|||
.mainpage-header { |
|||
display: flex; |
|||
margin: 2.6em 1.75em 1.5em; |
|||
.header-intro { |
|||
flex: 2; |
|||
h1 { |
|||
font-size: 2.5em; |
|||
font-weight: bold; |
|||
border: none; |
|||
margin: 0 0 .15em; |
|||
} |
|||
p { |
|||
font-size: 1.1em; |
|||
line-height: 1.7em; |
|||
} |
|||
} |
|||
.header-stats { |
|||
flex: 1; |
|||
display: flex; |
|||
justify-content: center; |
|||
align-items: center; |
|||
margin-top: -1em; |
|||
} |
|||
} |
|||
// main sections |
|||
.mainpage-body { |
|||
display: grid; |
|||
grid-template-areas: |
|||
"event event event" // for tbzr tile |
|||
"update update update" |
|||
"content content content" |
|||
"left left right"; |
|||
gap: 0.9rem; |
|||
grid-template-columns: repeat(3, 1fr); |
|||
h2 a { |
|||
color: var(--text-color); |
|||
} |
|||
.tile { |
|||
padding-left: 1.75em; |
|||
padding-right: 1.75em; |
|||
max-width: 100%; |
|||
} |
|||
.tile-row { |
|||
width: 100%; |
|||
margin-bottom: 0; |
|||
} |
|||
} |
|||
.mainpage-body .tile-row { |
|||
display: grid; |
|||
gap: 0.9rem |
|||
} |
|||
// left column |
|||
.mainpage-left { |
|||
grid-area: left; |
|||
flex: 2; |
|||
display: flex; |
|||
flex-flow: column wrap; |
|||
> * { |
|||
margin: 0 0 @mp-gutter-width; |
|||
} |
|||
} |
|||
// right column |
|||
.mainpage-right { |
|||
grid-area: right; |
|||
flex: 1; |
|||
display: flex; |
|||
flex-flow: column wrap; |
|||
> * { |
|||
margin: 0 0 @mp-gutter-width; |
|||
} |
|||
} |
|||
/* ==================== |
|||
components |
|||
==================== */ |
|||
.arrow { |
|||
background: url('filepath://White-chevron.svg') no-repeat; |
|||
display: inline-block; |
|||
height: .7rem; |
|||
width: .45rem; |
|||
vertical-align: middle; |
|||
&.dark { |
|||
filter: invert(80%); |
|||
} |
|||
} |
|||
/* ============================= |
|||
section-specific styles |
|||
============================= */ |
|||
/* -------------------- |
|||
recent updates |
|||
-------------------- */ |
|||
// big tile |
|||
/* unused |
|||
.tile.big-tile { |
|||
width: 100%; |
|||
background: linear-gradient(to left, var(--bigtile-background-fade-zero), var(--bigtile-background-fade-seventyfive), var(--bigtile-background-color) 40%), url("filepath://Main page Twisted League.png") right / auto 100% no-repeat @white; |
|||
margin-bottom: @mp-gutter-width; |
|||
padding-right: 8vw; |
|||
} */ |
|||
.mainpage-recent-updates { |
|||
grid-area: update; |
|||
grid-template-columns: repeat(3, 1fr); |
|||
.tile-halves { |
|||
flex: 1; |
|||
align-content: flex-start; |
|||
// zoom on hover |
|||
&:hover .tile-top img { |
|||
transform: scale(1.04); |
|||
} |
|||
.tile-top span { |
|||
width: 100%; |
|||
} |
|||
} |
|||
.tile-bottom.link-button a { |
|||
text-align: left; |
|||
padding: 1rem 1.5rem .75rem; |
|||
} |
|||
h2 { |
|||
margin: -0.5em 0 .3em; |
|||
} |
|||
p:not(.byline) { |
|||
font-size: .9em; |
|||
line-height: 1.75em; |
|||
color: var(--text-color); |
|||
} |
|||
} |
|||
/* -------------------- |
|||
wiki contents |
|||
-------------------- */ |
|||
@mp-contents-height: 4.5rem; |
|||
.mainpage-contents { |
|||
grid-area: content; |
|||
grid-template-columns: repeat(6, 1fr); |
|||
.tile-halves { |
|||
flex: 1; |
|||
} |
|||
.tile-top { |
|||
position: relative; // needed for ribbon |
|||
} |
|||
h2 { |
|||
margin: 0; |
|||
padding: 0; |
|||
} |
|||
.tile-bottom.link-button a { |
|||
padding: 0.75em 0.2em; // prevent grid gap misalignment |
|||
} |
|||
} |
|||
/* -------------------- |
|||
skill training |
|||
-------------------- */ |
|||
.mainpage-skills { |
|||
ul { |
|||
columns: 3 9em; |
|||
margin: 1em .7em .7em 1em; |
|||
} |
|||
// skill row |
|||
li { |
|||
display: flex; |
|||
margin-bottom: .29em; |
|||
// skill icon |
|||
span a { |
|||
border-radius: @border-radius; |
|||
padding: 4px; |
|||
width: 25px; |
|||
height: 25px; |
|||
text-align: center; |
|||
display: flex; |
|||
justify-content: center; |
|||
align-items: center; |
|||
} |
|||
// skill text |
|||
> a:last-child { |
|||
flex: 1; |
|||
display: flex; |
|||
align-items: center; |
|||
font-weight: bold; |
|||
padding-left: .7em; |
|||
text-decoration: none; |
|||
} |
|||
&:hover { |
|||
a:first-child { |
|||
border-radius: @border-radius 0 0 @border-radius; |
|||
} |
|||
> a:last-child { |
|||
color: @mp-text-light; |
|||
border-radius: 0 @border-radius @border-radius 0; |
|||
} |
|||
} |
|||
} |
|||
} |
|||
.skill-agility, |
|||
.skill-melee { |
|||
.skill-color( #932419 ); // red |
|||
} |
|||
.skill-ranged { |
|||
.skill-color( #4c6215 ); // green |
|||
} |
|||
.skill-magic { |
|||
.skill-color( #304791 ); // blurple |
|||
} |
|||
.skill-fishing, |
|||
.skill-fletching { |
|||
.skill-color( #1a6671 ); // bluish |
|||
} |
|||
.skill-cooking, |
|||
.skill-thieving { |
|||
.skill-color( #713684 ); // purple |
|||
} |
|||
.skill-farming, |
|||
.skill-woodcutting { |
|||
.skill-color( #306f25 ); // dark green |
|||
} |
|||
.skill-mining { |
|||
.skill-color( #315f8d ); // dark blue |
|||
} |
|||
.skill-smithing { |
|||
.skill-color( #b69213 ); // gold |
|||
} |
|||
/* -------------------- |
|||
popular mw.pages |
|||
-------------------- */ |
|||
.popular-mw.pages ul { |
|||
display: grid; |
|||
grid-template-columns: repeat(3, 1fr); |
|||
grid-gap: .6em; |
|||
margin: 1em 0 .7em 0; |
|||
} |
|||
// skill row |
|||
.mp-popular-page-light { |
|||
display: flex; |
|||
align-items: center; |
|||
background-color: var(--button-background); |
|||
transition: 100ms; |
|||
a { |
|||
flex: 1; |
|||
display: block; |
|||
color: @white; |
|||
font-weight: bold; |
|||
text-align: center; |
|||
text-decoration: none; |
|||
padding: .7em 1em; |
|||
} |
|||
&:hover { |
|||
filter: brightness(115%); |
|||
transition: 100ms; |
|||
} |
|||
} |
|||
/* -------------------- |
|||
discord server |
|||
-------------------- */ |
|||
.mainpage-discord { |
|||
border: none; |
|||
box-shadow: @box-shadow-dark; |
|||
.tile-top { |
|||
display: flex; |
|||
align-items: center; |
|||
background: @discord-bg; |
|||
padding: 1em 1.75em; |
|||
a { |
|||
flex: 1; |
|||
position: relative; // allow link to cover icon |
|||
text-decoration: none; |
|||
&:hover .arrow { |
|||
transform: translateX(50%); |
|||
} |
|||
} |
|||
} |
|||
.tile-bottom { |
|||
background: @discord-bg-dark; |
|||
border: none; |
|||
padding: 1em 1.75em; |
|||
p { |
|||
color: @white; |
|||
font-weight: bold; |
|||
font-size: .9em; |
|||
text-align: center; |
|||
text-transform: uppercase; |
|||
letter-spacing: .03em; |
|||
margin: 0; |
|||
} |
|||
} |
|||
.partner-icon { |
|||
margin-right: .75em; |
|||
} |
|||
.server-name { |
|||
color: @white; |
|||
font-weight: bold; |
|||
font-size: 1.25em; |
|||
margin: .5em 0 -0.15em; |
|||
} |
|||
.server-tagline { |
|||
color: @mp-text-light; |
|||
margin-bottom: .5em; |
|||
} |
|||
.arrow { |
|||
position: absolute; |
|||
top: ~"calc(50% - .5em)"; // center arrow on its point |
|||
right: 0; |
|||
height: 1em; |
|||
width: .7em; |
|||
background-size: .7em 1em; |
|||
transition: .3s ease-out; |
|||
} |
|||
} |
|||
/* -------------------- |
|||
X / Twitter |
|||
--------------------*/ |
|||
@twitter-bg: #15202b; |
|||
@twitter-bg-dark: #121c26; |
|||
.mainpage-twitter { |
|||
border: none; |
|||
box-shadow: @box-shadow-dark; |
|||
.tile-top { |
|||
display: flex; |
|||
align-items: center; |
|||
background: @twitter-bg; |
|||
padding: 1em 1.75em; |
|||
a { |
|||
flex: 1; |
|||
position: relative; // allow link to cover icon |
|||
text-decoration: none; |
|||
&:hover .arrow { |
|||
transform: translateX(50%); |
|||
} |
|||
} |
|||
} |
|||
.tile-bottom { |
|||
background: @twitter-bg-dark; |
|||
border: none; |
|||
padding: 1em 1.75em; |
|||
p { |
|||
color: @white; |
|||
font-weight: bold; |
|||
font-size: .9em; |
|||
text-align: center; |
|||
text-transform: uppercase; |
|||
letter-spacing: .03em; |
|||
margin: 0; |
|||
} |
|||
} |
|||
.twitter-logo { |
|||
margin-right: .75em; |
|||
} |
|||
.twitter-name { |
|||
color: @white; |
|||
font-weight: bold; |
|||
font-size: 1.25em; |
|||
margin: .5em 0 -0.15em; |
|||
} |
|||
.twitter-tagline { |
|||
color: @mp-text-light; |
|||
margin-bottom: .5em; |
|||
} |
|||
.arrow { |
|||
position: absolute; |
|||
top: ~"calc(50% - .5em)"; // center arrow on its point |
|||
right: 0; |
|||
height: 1em; |
|||
width: .7em; |
|||
background-size: .7em 1em; |
|||
transition: .3s ease-out; |
|||
} |
|||
} |
|||
/* -------------------- |
|||
edit the wiki |
|||
-------------------- */ |
|||
.mainpage-editing { |
|||
border: none; |
|||
box-shadow: @box-shadow-dark; |
|||
.tile-top { |
|||
background: @steel-blue; |
|||
} |
|||
.tile-bottom { |
|||
background: saturate( darken( @steel-blue, 4% ), 4% ); |
|||
border: none; |
|||
padding: .8rem 1.5rem .4rem; |
|||
} |
|||
h2, |
|||
a { |
|||
color: @white; |
|||
} |
|||
p { |
|||
color: @mp-text-light; |
|||
} |
|||
ul { |
|||
list-style-image: url('filepath://Transparent-chevron.svg'); |
|||
} |
|||
} |
|||
/* ========================== |
|||
poll |
|||
========================== */ |
|||
.mainpage-poll .ajaxpoll { |
|||
border: none; |
|||
background: none; |
|||
padding: 0; |
|||
width: auto; |
|||
} |
|||
/* ========================== |
|||
tbz(r) tile |
|||
========================== */ |
|||
.mainpage-trailblazer { |
|||
grid-area: event; |
|||
.tb-logo { |
|||
margin-bottom: @mp-gutter-width; |
|||
} |
|||
.tile-row { |
|||
grid-template-columns: repeat(3,1fr); |
|||
@media only screen and (max-width: @width-breakpoint-tablet) { |
|||
grid-template-columns: none; |
|||
.tile-top { |
|||
height: 20vw; |
|||
min-height: 9em; |
|||
} |
|||
} |
|||
} |
|||
} |
|||
/* ========================== |
|||
media queries |
|||
========================== */ |
|||
@media only screen and (max-width: @width-breakpoint-desktop-wide) { |
|||
// switch to two rows of three tiles |
|||
.mainpage-contents { |
|||
grid-template-columns: repeat(3, 1fr) |
|||
} |
|||
} |
|||
@media only screen and (max-width: @width-breakpoint-desktop) { |
|||
// mainpage-left and -right on one column now |
|||
.mainpage-body { |
|||
grid-template-areas: |
|||
"event event event" // for tbzr tile |
|||
"update update update" |
|||
"content content content" |
|||
"left left left" |
|||
"right right right"; |
|||
} |
|||
.mainpage-recent-updates { |
|||
grid-template-columns: repeat(2, 1fr); |
|||
.tile-halves { |
|||
// hide third recent update |
|||
&:last-child { |
|||
display: none; |
|||
} |
|||
// zoom on hover |
|||
&:hover .tile-top img { |
|||
transform: scale(1.04); |
|||
} |
|||
} |
|||
.tile-top { |
|||
height: 18vw; |
|||
min-height: 9em; |
|||
} |
|||
} |
|||
// hide other things |
|||
.mainpage-header .header-stats { |
|||
display: none; |
|||
} |
|||
// kill margin as it duplicates grid's gap |
|||
.mainpage-left > *:last-child, |
|||
.mainpage-right > *:last-child { |
|||
margin-bottom: 0; |
|||
} |
|||
.popular-mw.pages ul { |
|||
grid-template-columns: repeat(2, 1fr); |
|||
} |
|||
} |
|||
@media only screen and (max-width: @width-breakpoint-tablet) { |
|||
.mainpage-recent-updates { |
|||
// resulting in single column |
|||
grid-template-columns: none; |
|||
// revert display:none |
|||
.tile-halves:last-child { |
|||
display: flex; |
|||
} |
|||
} |
|||
// switch to three rows of two tiles |
|||
.mainpage-contents { |
|||
grid-template-columns: repeat(2, 1fr); |
|||
} |
|||
} |
|||
Revision as of 18:12, 17 October 2024
/* =================== MAIN PAGE =================== *//* =================== variables =================== */@mp-text-light: fade( @white, 90% );@mp-gutter-width: .9rem;/* unused:root { --bigtile-background-color: #f9f3eb; --bigtile-background-fade-zero: fade(#f9f3eb, 0%); --bigtile-background-fade-seventyfive: fade(#f9f3eb, 75%);}*//* =================== mixins =================== */// skill training colors.skill-color(@color) { // icon span a { background: desaturate( lighten( @color, 15% ), 20% ); } // skill name &:hover > a:last-child { background: @color; }}/* ========================== page-specific styles ========================== */body.page-Old_School_RuneScape_Wiki { // limit max width for readability // don't use #mw-content-text because it includes the editform .mw-parser-output { max-width: 75em; margin: 0 auto; } // not when editing &.action-view { .catlinks, #contentSub, // hide pagetitle in favor of .mainpage-header // Note: as of mw1.38, this is not needed anymore // blanking both MediaWiki:Mainpage-title-loggedin & // MediaWiki:Mainpage-title applies an inline `display: none;` // #firstHeading, // anything listed in the sitenotice should already be on the main page #siteNotice { display: none; } }}/* ==================== general styles ==================== */.mainpage-header { display: flex; margin: 2.6em 1.75em 1.5em; .header-intro { flex: 2; h1 { font-size: 2.5em; font-weight: bold; border: none; margin: 0 0 .15em; } p { font-size: 1.1em; line-height: 1.7em; } } .header-stats { flex: 1; display: flex; justify-content: center; align-items: center; margin-top: -1em; }}// main sections.mainpage-body { display: grid; grid-template-areas: "event event event" // for tbzr tile "update update update" "content content content" "left left right"; gap: 0.9rem; grid-template-columns: repeat(3, 1fr); h2 a { color: var(--text-color); } .tile { padding-left: 1.75em; padding-right: 1.75em; max-width: 100%; } .tile-row { width: 100%; margin-bottom: 0; }}.mainpage-body .tile-row { display: grid; gap: 0.9rem}// left column.mainpage-left { grid-area: left; flex: 2; display: flex; flex-flow: column wrap; > * { margin: 0 0 @mp-gutter-width; }}// right column.mainpage-right { grid-area: right; flex: 1; display: flex; flex-flow: column wrap; > * { margin: 0 0 @mp-gutter-width; }}/* ==================== components ==================== */.arrow { background: url('/images/rss/White-chevron.svg') no-repeat; display: inline-block; height: .7rem; width: .45rem; vertical-align: middle; &.dark { filter: invert(80%); }}/* ============================= section-specific styles ============================= *//* -------------------- recent updates -------------------- */// big tile/* unused.tile.big-tile { width: 100%; background: linear-gradient(to left, var(--bigtile-background-fade-zero), var(--bigtile-background-fade-seventyfive), var(--bigtile-background-color) 40%), url("/images/rss/Main page Twisted League.png") right / auto 100% no-repeat @white; margin-bottom: @mp-gutter-width; padding-right: 8vw;} */.mainpage-recent-updates { grid-area: update; grid-template-columns: repeat(3, 1fr); .tile-halves { flex: 1; align-content: flex-start; // zoom on hover &:hover .tile-top img { transform: scale(1.04); } .tile-top span { width: 100%; } } .tile-bottom.link-button a { text-align: left; padding: 1rem 1.5rem .75rem; } h2 { margin: -0.5em 0 .3em; } p:not(.byline) { font-size: .9em; line-height: 1.75em; color: var(--text-color); }}/* -------------------- wiki contents -------------------- */@mp-contents-height: 4.5rem;.mainpage-contents { grid-area: content; grid-template-columns: repeat(6, 1fr); .tile-halves { flex: 1; } .tile-top { position: relative; // needed for ribbon } h2 { margin: 0; padding: 0; } .tile-bottom.link-button a { padding: 0.75em 0.2em; // prevent grid gap misalignment }}/* -------------------- skill training -------------------- */.mainpage-skills { ul { columns: 3 9em; margin: 1em .7em .7em 1em; } // skill row li { display: flex; margin-bottom: .29em; // skill icon span a { border-radius: @border-radius; padding: 4px; width: 25px; height: 25px; text-align: center; display: flex; justify-content: center; align-items: center; } // skill text > a:last-child { flex: 1; display: flex; align-items: center; font-weight: bold; padding-left: .7em; text-decoration: none; } &:hover { a:first-child { border-radius: @border-radius 0 0 @border-radius; } > a:last-child { color: @mp-text-light; border-radius: 0 @border-radius @border-radius 0; } } }}.skill-agility,.skill-melee { .skill-color( #932419 ); // red}.skill-ranged { .skill-color( #4c6215 ); // green}.skill-magic { .skill-color( #304791 ); // blurple}.skill-fishing,.skill-fletching { .skill-color( #1a6671 ); // bluish}.skill-cooking,.skill-thieving { .skill-color( #713684 ); // purple}.skill-farming,.skill-woodcutting { .skill-color( #306f25 ); // dark green}.skill-mining { .skill-color( #315f8d ); // dark blue}.skill-smithing { .skill-color( #b69213 ); // gold}/* -------------------- popular pages -------------------- */.popular-pages ul { display: grid; grid-template-columns: repeat(3, 1fr); grid-gap: .6em; margin: 1em 0 .7em 0;}// skill row.mp-popular-page-light { display: flex; align-items: center; background-color: var(--button-background); transition: 100ms; a { flex: 1; display: block; color: @white; font-weight: bold; text-align: center; text-decoration: none; padding: .7em 1em; } &:hover { filter: brightness(115%); transition: 100ms; }}/* -------------------- discord server -------------------- */.mainpage-discord { border: none; box-shadow: @box-shadow-dark; .tile-top { display: flex; align-items: center; background: @discord-bg; padding: 1em 1.75em; a { flex: 1; position: relative; // allow link to cover icon text-decoration: none; &:hover .arrow { transform: translateX(50%); } } } .tile-bottom { background: @discord-bg-dark; border: none; padding: 1em 1.75em; p { color: @white; font-weight: bold; font-size: .9em; text-align: center; text-transform: uppercase; letter-spacing: .03em; margin: 0; } } .partner-icon { margin-right: .75em; } .server-name { color: @white; font-weight: bold; font-size: 1.25em; margin: .5em 0 -0.15em; } .server-tagline { color: @mp-text-light; margin-bottom: .5em; } .arrow { position: absolute; top: ~"calc(50% - .5em)"; // center arrow on its point right: 0; height: 1em; width: .7em; background-size: .7em 1em; transition: .3s ease-out; }}/* -------------------- X / Twitter --------------------*/@twitter-bg: #15202b;@twitter-bg-dark: #121c26;.mainpage-twitter { border: none; box-shadow: @box-shadow-dark; .tile-top { display: flex; align-items: center; background: @twitter-bg; padding: 1em 1.75em; a { flex: 1; position: relative; // allow link to cover icon text-decoration: none; &:hover .arrow { transform: translateX(50%); } } } .tile-bottom { background: @twitter-bg-dark; border: none; padding: 1em 1.75em; p { color: @white; font-weight: bold; font-size: .9em; text-align: center; text-transform: uppercase; letter-spacing: .03em; margin: 0; } } .twitter-logo { margin-right: .75em; } .twitter-name { color: @white; font-weight: bold; font-size: 1.25em; margin: .5em 0 -0.15em; } .twitter-tagline { color: @mp-text-light; margin-bottom: .5em; } .arrow { position: absolute; top: ~"calc(50% - .5em)"; // center arrow on its point right: 0; height: 1em; width: .7em; background-size: .7em 1em; transition: .3s ease-out; }}/* -------------------- edit the wiki -------------------- */.mainpage-editing { border: none; box-shadow: @box-shadow-dark; .tile-top { background: @steel-blue; } .tile-bottom { background: saturate( darken( @steel-blue, 4% ), 4% ); border: none; padding: .8rem 1.5rem .4rem; } h2, a { color: @white; } p { color: @mp-text-light; } ul { list-style-image: url('/images/rss/Transparent-chevron.svg'); }}/* ========================== poll ========================== */.mainpage-poll .ajaxpoll { border: none; background: none; padding: 0; width: auto;}/* ========================== tbz(r) tile ========================== */.mainpage-trailblazer { grid-area: event; .tb-logo { margin-bottom: @mp-gutter-width; } .tile-row { grid-template-columns: repeat(3,1fr); @media only screen and (max-width: @width-breakpoint-tablet) { grid-template-columns: none; .tile-top { height: 20vw; min-height: 9em; } } }}/* ========================== media queries ========================== */@media only screen and (max-width: @width-breakpoint-desktop-wide) { // switch to two rows of three tiles .mainpage-contents { grid-template-columns: repeat(3, 1fr) }}@media only screen and (max-width: @width-breakpoint-desktop) { // mainpage-left and -right on one column now .mainpage-body { grid-template-areas: "event event event" // for tbzr tile "update update update" "content content content" "left left left" "right right right"; } .mainpage-recent-updates { grid-template-columns: repeat(2, 1fr); .tile-halves { // hide third recent update &:last-child { display: none; } // zoom on hover &:hover .tile-top img { transform: scale(1.04); } } .tile-top { height: 18vw; min-height: 9em; } } // hide other things .mainpage-header .header-stats { display: none; } // kill margin as it duplicates grid's gap .mainpage-left > *:last-child, .mainpage-right > *:last-child { margin-bottom: 0; } .popular-pages ul { grid-template-columns: repeat(2, 1fr); }}@media only screen and (max-width: @width-breakpoint-tablet) { .mainpage-recent-updates { // resulting in single column grid-template-columns: none; // revert display:none .tile-halves:last-child { display: flex; } } // switch to three rows of two tiles .mainpage-contents { grid-template-columns: repeat(2, 1fr); }}